C15H18O3 — CID 164671453
2-[(2R)-1-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 164671453) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(2R)-1-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2R)-1-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 164671453 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[(2R)-1-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=C[C@@H](C[C@@H]1OC1(C)C)C1=CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C15H18O3/c1-5-10(7-14-15(3,4)18-14)11-8-12(16)9(2)6-13(11)17/h5-6,8,10,14H,1,7H2,2-4H3/t10-,14-/m0/s1 |
| InChIKey | RNQAITKJPMXSHD-HZMBPMFUSA-N |
| XLogP | 2.38 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|