C14H18O3Si — CID 164671487
(1R,2S,5R)-2-[dimethyl(phenyl)silyl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 164671487) has the molecular formula C14H18O3Si and a molecular weight of 262.38 g/mol. Its IUPAC name is (1R,2S,5R)-2-[dimethyl(phenyl)silyl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1R,2S,5R)-2-[dimethyl(phenyl)silyl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 164671487 |
| Molecular Formula | C14H18O3Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (1R,2S,5R)-2-[dimethyl(phenyl)silyl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1CC(=O)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C14H18O3Si/c1-18(2,10-6-4-3-5-7-10)13-8-11(15)14-16-9-12(13)17-14/h3-7,12-14H,8-9H2,1-2H3/t12-,13+,14-/m1/s1 |
| InChIKey | NLHVMQCKTPTLLO-HZSPNIEDSA-N |
| XLogP | 1.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|