C28H23N3O5 — CID 164671669
methyl (1'R,4'R,5'S,6'R)-2,4,6-trioxo-1',4',5'-triphenylspiro[1,3-diazinane-5,2'-3-azabicyclo[3.1.0]hexane]-6'-carboxylate (PubChem CID 164671669) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is methyl (1'R,4'R,5'S,6'R)-2,4,6-trioxo-1',4',5'-triphenylspiro[1,3-diazinane-5,2'-3-azabicyclo[3.1.0]hexane]-6'-carboxylate.
| Compound Name | methyl (1'R,4'R,5'S,6'R)-2,4,6-trioxo-1',4',5'-triphenylspiro[1,3-diazinane-5,2'-3-azabicyclo[3.1.0]hexane]-6'-carboxylate |
|---|---|
| PubChem CID | 164671669 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | methyl (1'R,4'R,5'S,6'R)-2,4,6-trioxo-1',4',5'-triphenylspiro[1,3-diazinane-5,2'-3-azabicyclo[3.1.0]hexane]-6'-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@]2(c3ccccc3)[C@@H](c3ccccc3)NC3(C(=O)NC(=O)NC3=O)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C28H23N3O5/c1-36-22(32)20-26(18-13-7-3-8-14-18)21(17-11-5-2-6-12-17)31-28(23(33)29-25(35)30-24(28)34)27(20,26)19-15-9-4-10-16-19/h2-16,20-21,31H,1H3,(H2,29,30,33,34,35)/t20-,21-,26+,27+/m1/s1 |
| InChIKey | LHEBTJVWXNLQSC-UXUXNBJMSA-N |
| XLogP | 2.11 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|