C23H38O4 — CID 164671697
ethyl 2-[(1R,2R,4aR,6S,8aR)-6-acetyloxy-2,5,5,8a-tetramethyl-2-[(Z)-prop-1-enyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate (PubChem CID 164671697) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,4aR,6S,8aR)-6-acetyloxy-2,5,5,8a-tetramethyl-2-[(Z)-prop-1-enyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,2R,4aR,6S,8aR)-6-acetyloxy-2,5,5,8a-tetramethyl-2-[(Z)-prop-1-enyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 164671697 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | ethyl 2-[(1R,2R,4aR,6S,8aR)-6-acetyloxy-2,5,5,8a-tetramethyl-2-[(Z)-prop-1-enyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate |
| SMILES | C/C=C\[C@@]1(C)CC[C@H]2C(C)(C)[C@@H](OC(C)=O)CC[C@]2(C)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C23H38O4/c1-8-12-22(6)13-10-17-21(4,5)19(27-16(3)24)11-14-23(17,7)18(22)15-20(25)26-9-2/h8,12,17-19H,9-11,13-15H2,1-7H3/b12-8-/t17-,18+,19-,22-,23-/m0/s1 |
| InChIKey | WCQUNTDKVSFXNM-JMRJWRFDSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|