C14H23F2N — CID 164672084
(2R)-1-[(1E,3S)-3,6-dimethylhepta-1,5-dienyl]-4,4-difluoro-2-methylpyrrolidine (PubChem CID 164672084) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is (2R)-1-[(1E,3S)-3,6-dimethylhepta-1,5-dienyl]-4,4-difluoro-2-methylpyrrolidine.
| Compound Name | (2R)-1-[(1E,3S)-3,6-dimethylhepta-1,5-dienyl]-4,4-difluoro-2-methylpyrrolidine |
|---|---|
| PubChem CID | 164672084 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (2R)-1-[(1E,3S)-3,6-dimethylhepta-1,5-dienyl]-4,4-difluoro-2-methylpyrrolidine |
| SMILES | CC(C)=CC[C@H](C)/C=C/N1CC(F)(F)C[C@H]1C |
| InChI | InChI=1S/C14H23F2N/c1-11(2)5-6-12(3)7-8-17-10-14(15,16)9-13(17)4/h5,7-8,12-13H,6,9-10H2,1-4H3/b8-7+/t12-,13+/m0/s1 |
| InChIKey | HKCDIIDTUHGMDP-AHYBDNRGSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|