C16H17FO5 — CID 164672096
cis-diethyl (2S,3S)-2-(2-fluorophenyl)-3-formylcyclopropane-1,1-dicarboxylate (PubChem CID 164672096) has the molecular formula C16H17FO5 and a molecular weight of 308.31 g/mol. Its IUPAC name is cis-diethyl (2S,3S)-2-(2-fluorophenyl)-3-formylcyclopropane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (2S,3S)-2-(2-fluorophenyl)-3-formylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 164672096 |
| Molecular Formula | C16H17FO5 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | cis-diethyl (2S,3S)-2-(2-fluorophenyl)-3-formylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](C=O)[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C16H17FO5/c1-3-21-14(19)16(15(20)22-4-2)11(9-18)13(16)10-7-5-6-8-12(10)17/h5-9,11,13H,3-4H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | SISQINSVIYHUJH-AAEUAGOBSA-N |
| XLogP | 1.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|