About 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide
2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide (PubChem CID 164672156) has the molecular formula C13H24FNO2
and a molecular weight of 245.34 g/mol. Its IUPAC name is 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide |
| PubChem CID | 164672156 |
| Molecular Formula | C13H24FNO2 |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide |
| SMILES | C=C[C@@H](NC(=O)CF)[C@H](CCCCCC)OC |
| InChI | InChI=1S/C13H24FNO2/c1-4-6-7-8-9-12(17-3)11(5-2)15-13(16)10-14/h5,11-12H,2,4,6-10H2,1,3H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | RDPCFLPXZQSWJJ-NEPJUHHUSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide?
The IUPAC name of 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide (CID 164672156) is 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide.
What is the SMILES notation for 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide?
The canonical SMILES for 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide is C=C[C@@H](NC(=O)CF)[C@H](CCCCCC)OC.
What is the InChIKey of 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide?
The InChIKey is RDPCFLPXZQSWJJ-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H24FNO2/c1-4-6-7-8-9-12(17-3)11(5-2)15-13(16)10-14/h5,11-12H,2,4,6-10H2,1,3H3,(H,15,16)/t11-,12+/m1/s1.
What are the key properties of 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide?
2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide has a molecular weight of 245.34 g/mol, XLogP of 2.61, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(3R,4S)-4-methoxydec-1-en-3-yl]acetamide is sourced from PubChem (CID 164672156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).