About N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt
N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt (PubChem CID 164672463) has the molecular formula C34H39Cl2CoNP2
and a molecular weight of 653.48 g/mol. Its IUPAC name is N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt.
Molecular Properties
| Compound Name | N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt |
| PubChem CID | 164672463 |
| Molecular Formula | C34H39Cl2CoNP2 |
| Molecular Weight | 653.48 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt |
| SMILES | Cl[Co]Cl.c1ccc(P(CCN(CCP(c2ccccc2)c2ccccc2)C2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H39NP2.2ClH.Co/c1-6-16-30(17-7-1)35(26-28-36(31-18-8-2-9-19-31)32-20-10-3-11-21-32)27-29-37(33-22-12-4-13-23-33)34-24-14-5-15-25-34;;;/h2-5,8-15,18-25,30H,1,6-7,16-17,26-29H2;2*1H;/q;;;+2/p-2 |
| InChIKey | RQGSYLIKAOZORW-UHFFFAOYSA-L |
| XLogP | 8.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 653.48 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt?
The IUPAC name of N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt (CID 164672463) is N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt.
What is the SMILES notation for N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt?
The canonical SMILES for N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt is Cl[Co]Cl.c1ccc(P(CCN(CCP(c2ccccc2)c2ccccc2)C2CCCCC2)c2ccccc2)cc1.
What is the InChIKey of N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt?
The InChIKey is RQGSYLIKAOZORW-UHFFFAOYSA-L. The full InChI is InChI=1S/C34H39NP2.2ClH.Co/c1-6-16-30(17-7-1)35(26-28-36(31-18-8-2-9-19-31)32-20-10-3-11-21-32)27-29-37(33-22-12-4-13-23-33)34-24-14-5-15-25-34;;;/h2-5,8-15,18-25,30H,1,6-7,16-17,26-29H2;2*1H;/q;;;+2/p-2.
What are the key properties of N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt?
N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt has a molecular weight of 653.48 g/mol, XLogP of 8.26, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-diphenylphosphanylethyl)cyclohexanamine;dichlorocobalt is sourced from PubChem (CID 164672463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).