About (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol
(4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol (PubChem CID 164672667) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol |
| PubChem CID | 164672667 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol |
| SMILES | C=C(/C=C/CCCO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-13(10-8-7-9-11-15)12-16-17(5,6)14(2,3)4/h8,10,15H,1,7,9,11-12H2,2-6H3/b10-8+ |
| InChIKey | NDPKVNBPWCFWCW-CSKARUKUSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol?
The IUPAC name of (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol (CID 164672667) is (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol.
What is the SMILES notation for (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol?
The canonical SMILES for (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol is C=C(/C=C/CCCO)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol?
The InChIKey is NDPKVNBPWCFWCW-CSKARUKUSA-N. The full InChI is InChI=1S/C14H28O2Si/c1-13(10-8-7-9-11-15)12-16-17(5,6)14(2,3)4/h8,10,15H,1,7,9,11-12H2,2-6H3/b10-8+.
What are the key properties of (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol?
(4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol has a molecular weight of 256.46 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-4,6-dien-1-ol is sourced from PubChem (CID 164672667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).