O12P4Si — CID 164672889
dioxosilane;2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide (PubChem CID 164672889) has the molecular formula O12P4Si and a molecular weight of 343.97 g/mol. Its IUPAC name is dioxosilane;2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide.
| Compound Name | dioxosilane;2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide |
|---|---|
| PubChem CID | 164672889 |
| Molecular Formula | O12P4Si |
| Molecular Weight | 343.97 g/mol |
| Exact Mass | 343.81 |
| IUPAC Name | dioxosilane;2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3.O=[Si]=O |
| InChI | InChI=1S/O10P4.O2Si/c1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12;1-3-2 |
| InChIKey | SNIGKGHADLYLNB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.97 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|