C10H13BrO — CID 164673222
(6E,8E)-2-bromodeca-1,6,8-trien-5-one (PubChem CID 164673222) has the molecular formula C10H13BrO and a molecular weight of 229.12 g/mol. Its IUPAC name is (6E,8E)-2-bromodeca-1,6,8-trien-5-one.
| Compound Name | (6E,8E)-2-bromodeca-1,6,8-trien-5-one |
|---|---|
| PubChem CID | 164673222 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (6E,8E)-2-bromodeca-1,6,8-trien-5-one |
| SMILES | C=C(Br)CCC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C10H13BrO/c1-3-4-5-6-10(12)8-7-9(2)11/h3-6H,2,7-8H2,1H3/b4-3+,6-5+ |
| InChIKey | KKGKOGDDUQPTIM-VNKDHWASSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|