C17H26O3 — CID 164673223
(2E,4E,10E)-12,12-diethoxy-9-methylidenedodeca-2,4,10-trien-6-one (PubChem CID 164673223) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2E,4E,10E)-12,12-diethoxy-9-methylidenedodeca-2,4,10-trien-6-one.
| Compound Name | (2E,4E,10E)-12,12-diethoxy-9-methylidenedodeca-2,4,10-trien-6-one |
|---|---|
| PubChem CID | 164673223 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2E,4E,10E)-12,12-diethoxy-9-methylidenedodeca-2,4,10-trien-6-one |
| SMILES | C=C(/C=C/C(OCC)OCC)CCC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C17H26O3/c1-5-8-9-10-16(18)13-11-15(4)12-14-17(19-6-2)20-7-3/h5,8-10,12,14,17H,4,6-7,11,13H2,1-3H3/b8-5+,10-9+,14-12+ |
| InChIKey | MGOYYGNHMTZKRM-JADMZECVSA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|