C15H27NO — CID 164673256
(2R,6S)-4-[(E)-3-cyclohexylprop-2-enyl]-2,6-dimethylmorpholine (PubChem CID 164673256) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2R,6S)-4-[(E)-3-cyclohexylprop-2-enyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[(E)-3-cyclohexylprop-2-enyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 164673256 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2R,6S)-4-[(E)-3-cyclohexylprop-2-enyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(C/C=C/C2CCCCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H27NO/c1-13-11-16(12-14(2)17-13)10-6-9-15-7-4-3-5-8-15/h6,9,13-15H,3-5,7-8,10-12H2,1-2H3/b9-6+/t13-,14+ |
| InChIKey | ZGIVJXHPPIFFNS-YLXGSJGQSA-N |
| XLogP | 3.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|