About (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile
(1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile (PubChem CID 164673366) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile.
Molecular Properties
| Compound Name | (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile |
| PubChem CID | 164673366 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile |
| SMILES | CC(C)(C)N1C[C@H]2C(C)(C)[C@@]2(C#N)C1=O |
| InChI | InChI=1S/C12H18N2O/c1-10(2,3)14-6-8-11(4,5)12(8,7-13)9(14)15/h8H,6H2,1-5H3/t8-,12+/m0/s1 |
| InChIKey | QRQXDEGNVYBDHT-QPUJVOFHSA-N |
| XLogP | 1.79 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile?
The IUPAC name of (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile (CID 164673366) is (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile.
What is the SMILES notation for (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile?
The canonical SMILES for (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile is CC(C)(C)N1C[C@H]2C(C)(C)[C@@]2(C#N)C1=O.
What is the InChIKey of (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile?
The InChIKey is QRQXDEGNVYBDHT-QPUJVOFHSA-N. The full InChI is InChI=1S/C12H18N2O/c1-10(2,3)14-6-8-11(4,5)12(8,7-13)9(14)15/h8H,6H2,1-5H3/t8-,12+/m0/s1.
What are the key properties of (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile?
(1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile has a molecular weight of 206.29 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-3-tert-butyl-6,6-dimethyl-2-oxo-3-azabicyclo[3.1.0]hexane-1-carbonitrile is sourced from PubChem (CID 164673366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).