C14H18O4 — CID 164673423
(4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-prop-2-ynyl-1,3,7-trioxaspiro[4.4]nonan-6-one (PubChem CID 164673423) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-prop-2-ynyl-1,3,7-trioxaspiro[4.4]nonan-6-one.
| Compound Name | (4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-prop-2-ynyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 164673423 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-prop-2-ynyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
| SMILES | C#CC[C@H]1OC(C)(C)O[C@@]12C(=O)OC[C@@]2(C)C=C |
| InChI | InChI=1S/C14H18O4/c1-6-8-10-14(18-12(3,4)17-10)11(15)16-9-13(14,5)7-2/h1,7,10H,2,8-9H2,3-5H3/t10-,13-,14-/m1/s1 |
| InChIKey | RAZJSZODZLJEIV-LERXQTSPSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|