C13H16O5 — CID 164673632
(8aR,8bR)-3a,4-dihydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione (PubChem CID 164673632) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (8aR,8bR)-3a,4-dihydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione.
| Compound Name | (8aR,8bR)-3a,4-dihydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione |
|---|---|
| PubChem CID | 164673632 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (8aR,8bR)-3a,4-dihydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione |
| SMILES | CC1=C2CC(O)C3(O)C(=O)OC[C@@]3(C)[C@@H]2CC1=O |
| InChI | InChI=1S/C13H16O5/c1-6-7-3-10(15)13(17)11(16)18-5-12(13,2)8(7)4-9(6)14/h8,10,15,17H,3-5H2,1-2H3/t8-,10?,12+,13?/m1/s1 |
| InChIKey | GQOIWZICLSNVJT-FDEBWUJXSA-N |
| XLogP | -0.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |