C24H30N2O4S — CID 164673734
S-benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanethioate (PubChem CID 164673734) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is S-benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanethioate.
| Compound Name | S-benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanethioate |
|---|---|
| PubChem CID | 164673734 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | S-benzyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanethioate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-17(25-23(29)30-24(2,3)4)21(27)26-20(15-18-11-7-5-8-12-18)22(28)31-16-19-13-9-6-10-14-19/h5-14,17,20H,15-16H2,1-4H3,(H,25,29)(H,26,27)/t17-,20-/m0/s1 |
| InChIKey | HHUAJPIVBLIOQK-PXNSSMCTSA-N |
| XLogP | 4.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|