C24H29BO3 — CID 164673811
(1R)-3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-inden-2-one (PubChem CID 164673811) has the molecular formula C24H29BO3 and a molecular weight of 376.31 g/mol. Its IUPAC name is (1R)-3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-inden-2-one.
| Compound Name | (1R)-3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-inden-2-one |
|---|---|
| PubChem CID | 164673811 |
| Molecular Formula | C24H29BO3 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1R)-3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-inden-2-one |
| SMILES | CC1(C)C(=O)[C@H](Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H29BO3/c1-22(2)20-10-8-7-9-18(20)19(21(22)26)15-16-11-13-17(14-12-16)25-27-23(3,4)24(5,6)28-25/h7-14,19H,15H2,1-6H3/t19-/m1/s1 |
| InChIKey | JDXBIEKLDDVNOI-LJQANCHMSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|