About (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one
(4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one (PubChem CID 164673919) has the molecular formula C20H20F3NO2
and a molecular weight of 363.38 g/mol. Its IUPAC name is (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one.
Molecular Properties
| Compound Name | (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one |
| PubChem CID | 164673919 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one |
| SMILES | O=C(CC[C@H](/C=N/OCc1ccccc1)CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H20F3NO2/c21-20(22,23)13-17(11-12-19(25)18-9-5-2-6-10-18)14-24-26-15-16-7-3-1-4-8-16/h1-10,14,17H,11-13,15H2/b24-14+/t17-/m0/s1 |
| InChIKey | NYSDGJOXTSMUOH-ZZQPOVDQSA-N |
| XLogP | 5.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one?
The IUPAC name of (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one (CID 164673919) is (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one.
What is the SMILES notation for (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one?
The canonical SMILES for (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one is O=C(CC[C@H](/C=N/OCc1ccccc1)CC(F)(F)F)c1ccccc1.
What is the InChIKey of (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one?
The InChIKey is NYSDGJOXTSMUOH-ZZQPOVDQSA-N. The full InChI is InChI=1S/C20H20F3NO2/c21-20(22,23)13-17(11-12-19(25)18-9-5-2-6-10-18)14-24-26-15-16-7-3-1-4-8-16/h1-10,14,17H,11-13,15H2/b24-14+/t17-/m0/s1.
What are the key properties of (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one?
(4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one has a molecular weight of 363.38 g/mol, XLogP of 5.42, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6,6,6-trifluoro-1-phenyl-4-[(E)-phenylmethoxyiminomethyl]hexan-1-one is sourced from PubChem (CID 164673919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).