C17H18N2OS — CID 164674011
(2R,3S)-2-(1-phenylpyrazol-4-yl)-3-thiophen-3-ylbutan-2-ol (PubChem CID 164674011) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is (2R,3S)-2-(1-phenylpyrazol-4-yl)-3-thiophen-3-ylbutan-2-ol.
| Compound Name | (2R,3S)-2-(1-phenylpyrazol-4-yl)-3-thiophen-3-ylbutan-2-ol |
|---|---|
| PubChem CID | 164674011 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2R,3S)-2-(1-phenylpyrazol-4-yl)-3-thiophen-3-ylbutan-2-ol |
| SMILES | C[C@@H](c1ccsc1)[C@@](C)(O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2OS/c1-13(14-8-9-21-12-14)17(2,20)15-10-18-19(11-15)16-6-4-3-5-7-16/h3-13,20H,1-2H3/t13-,17+/m0/s1 |
| InChIKey | WPONLMXUAJDGDN-SUMWQHHRSA-N |
| XLogP | 3.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |