C21H25F3O5S — CID 164674047
[2-[2-[(2S,7aR)-2-hydroxy-5,7a-dimethyl-1,2,3,7-tetrahydroinden-4-yl]ethyl]-4-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 164674047) has the molecular formula C21H25F3O5S and a molecular weight of 446.49 g/mol. Its IUPAC name is [2-[2-[(2S,7aR)-2-hydroxy-5,7a-dimethyl-1,2,3,7-tetrahydroinden-4-yl]ethyl]-4-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-[(2S,7aR)-2-hydroxy-5,7a-dimethyl-1,2,3,7-tetrahydroinden-4-yl]ethyl]-4-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164674047 |
| Molecular Formula | C21H25F3O5S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [2-[2-[(2S,7aR)-2-hydroxy-5,7a-dimethyl-1,2,3,7-tetrahydroinden-4-yl]ethyl]-4-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)C(F)(F)F)c(CCC2=C3C[C@@H](O)C[C@@]3(C)CC=C2C)c1 |
| InChI | InChI=1S/C21H25F3O5S/c1-13-8-9-20(2)12-15(25)11-18(20)17(13)6-4-14-10-16(28-3)5-7-19(14)29-30(26,27)21(22,23)24/h5,7-8,10,15,25H,4,6,9,11-12H2,1-3H3/t15-,20-/m1/s1 |
| InChIKey | TWKDICSGRFOWBW-FOIQADDNSA-N |
| XLogP | 4.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|