C31H44O3 — CID 164674159
(5R)-4-methoxy-8-methyl-3-[(1E)-3-methylbuta-1,3-dienyl]-5,7,8-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 164674159) has the molecular formula C31H44O3 and a molecular weight of 464.69 g/mol. Its IUPAC name is (5R)-4-methoxy-8-methyl-3-[(1E)-3-methylbuta-1,3-dienyl]-5,7,8-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (5R)-4-methoxy-8-methyl-3-[(1E)-3-methylbuta-1,3-dienyl]-5,7,8-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 164674159 |
| Molecular Formula | C31H44O3 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (5R)-4-methoxy-8-methyl-3-[(1E)-3-methylbuta-1,3-dienyl]-5,7,8-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=C(C)/C=C/C1=C(OC)[C@@]2(CC=C(C)C)CC(CC=C(C)C)C(C)(CC=C(C)C)C(C1=O)C2=O |
| InChI | InChI=1S/C31H44O3/c1-20(2)11-13-24-19-31(18-16-23(7)8)28(33)26(30(24,9)17-15-22(5)6)27(32)25(29(31)34-10)14-12-21(3)4/h11-12,14-16,24,26H,3,13,17-19H2,1-2,4-10H3/b14-12+/t24?,26?,30?,31-/m0/s1 |
| InChIKey | KMRUVTVHFBCZQN-WMACWJAKSA-N |
| XLogP | 7.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|