C22H28O4 — CID 164674168
[(1S,4S,5R,7R,9R,10R,13R,14R)-2,6,6,9,12-pentamethyl-16-oxo-15-oxapentacyclo[11.2.1.04,14.05,7.010,14]hexadeca-2,11-dien-1-yl] acetate (PubChem CID 164674168) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(1S,4S,5R,7R,9R,10R,13R,14R)-2,6,6,9,12-pentamethyl-16-oxo-15-oxapentacyclo[11.2.1.04,14.05,7.010,14]hexadeca-2,11-dien-1-yl] acetate.
| Compound Name | [(1S,4S,5R,7R,9R,10R,13R,14R)-2,6,6,9,12-pentamethyl-16-oxo-15-oxapentacyclo[11.2.1.04,14.05,7.010,14]hexadeca-2,11-dien-1-yl] acetate |
|---|---|
| PubChem CID | 164674168 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(1S,4S,5R,7R,9R,10R,13R,14R)-2,6,6,9,12-pentamethyl-16-oxo-15-oxapentacyclo[11.2.1.04,14.05,7.010,14]hexadeca-2,11-dien-1-yl] acetate |
| SMILES | CC(=O)O[C@]12O[C@]34[C@H](C1=O)C(C)=C[C@H]3[C@H](C)C[C@@H]1[C@H]([C@@H]4C=C2C)C1(C)C |
| InChI | InChI=1S/C22H28O4/c1-10-7-15-18(20(15,5)6)16-9-12(3)22(25-13(4)23)19(24)17-11(2)8-14(10)21(16,17)26-22/h8-10,14-18H,7H2,1-6H3/t10-,14+,15-,16+,17+,18-,21-,22-/m1/s1 |
| InChIKey | CGLPBLDJERWACN-ZKCQISEHSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|