C12H12O3 — CID 164674231
2,4,6-tri(ethylidene)cyclohexane-1,3,5-trione (PubChem CID 164674231) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2,4,6-tri(ethylidene)cyclohexane-1,3,5-trione.
| Compound Name | 2,4,6-tri(ethylidene)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 164674231 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2,4,6-tri(ethylidene)cyclohexane-1,3,5-trione |
| SMILES | CC=C1C(=O)C(=CC)C(=O)C(=CC)C1=O |
| InChI | InChI=1S/C12H12O3/c1-4-7-10(13)8(5-2)12(15)9(6-3)11(7)14/h4-6H,1-3H3/b7-4-,8-5-,9-6- |
| InChIKey | XZAQFUIMYNWOKQ-PXLQOLDUSA-N |
| XLogP | 1.55 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|