About [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane
[(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane (PubChem CID 164674364) has the molecular formula C13H24OSi
and a molecular weight of 224.42 g/mol. Its IUPAC name is [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane |
| PubChem CID | 164674364 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane |
| SMILES | CC1(C)C[C@@H]2C(O[Si](C)(C)C)=CCC[C@@H]21 |
| InChI | InChI=1S/C13H24OSi/c1-13(2)9-10-11(13)7-6-8-12(10)14-15(3,4)5/h8,10-11H,6-7,9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | RTJLAGBCBWFCBW-QWRGUYRKSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane?
The IUPAC name of [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane (CID 164674364) is [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane.
What is the SMILES notation for [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane?
The canonical SMILES for [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane is CC1(C)C[C@@H]2C(O[Si](C)(C)C)=CCC[C@@H]21.
What is the InChIKey of [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane?
The InChIKey is RTJLAGBCBWFCBW-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H24OSi/c1-13(2)9-10-11(13)7-6-8-12(10)14-15(3,4)5/h8,10-11H,6-7,9H2,1-5H3/t10-,11-/m0/s1.
What are the key properties of [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane?
[(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane has a molecular weight of 224.42 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,6S)-7,7-dimethyl-2-bicyclo[4.2.0]oct-2-enyl]oxy-trimethylsilane is sourced from PubChem (CID 164674364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).