C16H21NO3 — CID 164674397
6-methyl-9-azatricyclo[7.4.3.04,13]hexadec-1(13)-ene-2,8,10-trione (PubChem CID 164674397) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-methyl-9-azatricyclo[7.4.3.04,13]hexadec-1(13)-ene-2,8,10-trione.
| Compound Name | 6-methyl-9-azatricyclo[7.4.3.04,13]hexadec-1(13)-ene-2,8,10-trione |
|---|---|
| PubChem CID | 164674397 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 6-methyl-9-azatricyclo[7.4.3.04,13]hexadec-1(13)-ene-2,8,10-trione |
| SMILES | CC1CC(=O)N2CCCC3=C(CCC2=O)C(CC3=O)C1 |
| InChI | InChI=1S/C16H21NO3/c1-10-7-11-9-14(18)13-3-2-6-17(16(20)8-10)15(19)5-4-12(11)13/h10-11H,2-9H2,1H3 |
| InChIKey | ZWESIOAFAKDCFA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|