About 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one
2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 164674450) has the molecular formula C8H8O2
and a molecular weight of 137.16 g/mol. Its IUPAC name is 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one |
| PubChem CID | 164674450 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | [2H]c1cc2c(o1)CCCC2=O |
| InChI | InChI=1S/C8H8O2/c9-7-2-1-3-8-6(7)4-5-10-8/h4-5H,1-3H2/i5D |
| InChIKey | DXWQOYPYNPSVRL-UICOGKGYSA-N |
| XLogP | 1.80 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one?
The IUPAC name of 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one (CID 164674450) is 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one.
What is the SMILES notation for 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one?
The canonical SMILES for 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one is [2H]c1cc2c(o1)CCCC2=O.
What is the InChIKey of 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one?
The InChIKey is DXWQOYPYNPSVRL-UICOGKGYSA-N. The full InChI is InChI=1S/C8H8O2/c9-7-2-1-3-8-6(7)4-5-10-8/h4-5H,1-3H2/i5D.
What are the key properties of 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one?
2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one has a molecular weight of 137.16 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-6,7-dihydro-5H-1-benzofuran-4-one is sourced from PubChem (CID 164674450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).