C21H38O2Si — CID 164674454
(2S,3S)-2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-6-methylidenecyclohexyl]-3-methylpent-4-en-1-ol (PubChem CID 164674454) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (2S,3S)-2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-6-methylidenecyclohexyl]-3-methylpent-4-en-1-ol.
| Compound Name | (2S,3S)-2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-6-methylidenecyclohexyl]-3-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 164674454 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (2S,3S)-2-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-6-methylidenecyclohexyl]-3-methylpent-4-en-1-ol |
| SMILES | C=C[C@@H]1[C@@H]([C@@H](CO)[C@@H](C)C=C)C(=C)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-10-15(3)18(14-22)20-16(4)12-13-19(17(20)11-2)23-24(8,9)21(5,6)7/h10-11,15,17-20,22H,1-2,4,12-14H2,3,5-9H3/t15-,17-,18-,19+,20-/m0/s1 |
| InChIKey | NYDLTRNUJODGQM-XCZFOBESSA-N |
| XLogP | 5.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|