C23H32O5 — CID 164674479
(3S,3aS,4S,5R,6aS)-4-ethenyl-5-hydroxy-5-methyl-3-[(8S,10R)-7-methylidene-10-prop-1-en-2-yl-1,4-dioxaspiro[4.6]undecan-8-yl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 164674479) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (3S,3aS,4S,5R,6aS)-4-ethenyl-5-hydroxy-5-methyl-3-[(8S,10R)-7-methylidene-10-prop-1-en-2-yl-1,4-dioxaspiro[4.6]undecan-8-yl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3S,3aS,4S,5R,6aS)-4-ethenyl-5-hydroxy-5-methyl-3-[(8S,10R)-7-methylidene-10-prop-1-en-2-yl-1,4-dioxaspiro[4.6]undecan-8-yl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 164674479 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (3S,3aS,4S,5R,6aS)-4-ethenyl-5-hydroxy-5-methyl-3-[(8S,10R)-7-methylidene-10-prop-1-en-2-yl-1,4-dioxaspiro[4.6]undecan-8-yl]-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=C[C@H]1[C@H]2[C@H]([C@@H]3C[C@@H](C(=C)C)CC4(CC3=C)OCCO4)C(=O)O[C@H]2C[C@@]1(C)O |
| InChI | InChI=1S/C23H32O5/c1-6-17-20-18(12-22(17,5)25)28-21(24)19(20)16-9-15(13(2)3)11-23(10-14(16)4)26-7-8-27-23/h6,15-20,25H,1-2,4,7-12H2,3,5H3/t15-,16-,17+,18+,19+,20-,22-/m1/s1 |
| InChIKey | PMEKISRVRKCRKE-VCWGYAJISA-N |
| XLogP | 3.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|