C19H24O5 — CID 164674480
(1S,2S,4R,9R,10R,11R,13S,16S)-9,11-dihydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-7-ene-6,15-dione (PubChem CID 164674480) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,2S,4R,9R,10R,11R,13S,16S)-9,11-dihydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-7-ene-6,15-dione.
| Compound Name | (1S,2S,4R,9R,10R,11R,13S,16S)-9,11-dihydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-7-ene-6,15-dione |
|---|---|
| PubChem CID | 164674480 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (1S,2S,4R,9R,10R,11R,13S,16S)-9,11-dihydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-7-ene-6,15-dione |
| SMILES | C=C(C)[C@H]1CC(=O)C=C2[C@@H](C1)[C@@H]1C(=O)O[C@H]3C[C@@](C)(O)[C@H]([C@@H]13)[C@H]2O |
| InChI | InChI=1S/C19H24O5/c1-8(2)9-4-10(20)6-12-11(5-9)14-15-13(24-18(14)22)7-19(3,23)16(15)17(12)21/h6,9,11,13-17,21,23H,1,4-5,7H2,2-3H3/t9-,11+,13-,14-,15+,16+,17-,19+/m0/s1 |
| InChIKey | BULCUXKFWLULJL-YUDBZDQASA-N |
| XLogP | 1.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|