C19H27NO3 — CID 164674512
propan-2-yl 3-hydroxy-8-[(1R)-1-phenylethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 164674512) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is propan-2-yl 3-hydroxy-8-[(1R)-1-phenylethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | propan-2-yl 3-hydroxy-8-[(1R)-1-phenylethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 164674512 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | propan-2-yl 3-hydroxy-8-[(1R)-1-phenylethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CC(C)OC(=O)C1C(O)CC2CCC1N2[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-12(2)23-19(22)18-16-10-9-15(11-17(18)21)20(16)13(3)14-7-5-4-6-8-14/h4-8,12-13,15-18,21H,9-11H2,1-3H3/t13-,15?,16?,17?,18?/m1/s1 |
| InChIKey | KWWDCQBCFTUCTI-MZHSRFCDSA-N |
| XLogP | 2.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |