C17H24O6 — CID 164674652
methyl (Z)-5-[(2R,4aR,5R,6S,7aS)-6-hydroxy-5'-oxospiro[4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-2,2'-oxolane]-5-yl]pent-3-enoate (PubChem CID 164674652) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is methyl (Z)-5-[(2R,4aR,5R,6S,7aS)-6-hydroxy-5'-oxospiro[4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-2,2'-oxolane]-5-yl]pent-3-enoate.
| Compound Name | methyl (Z)-5-[(2R,4aR,5R,6S,7aS)-6-hydroxy-5'-oxospiro[4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-2,2'-oxolane]-5-yl]pent-3-enoate |
|---|---|
| PubChem CID | 164674652 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl (Z)-5-[(2R,4aR,5R,6S,7aS)-6-hydroxy-5'-oxospiro[4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-2,2'-oxolane]-5-yl]pent-3-enoate |
| SMILES | COC(=O)C/C=C\C[C@@H]1[C@H]2CC[C@@]3(CCC(=O)O3)O[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C17H24O6/c1-21-15(19)5-3-2-4-11-12-6-8-17(9-7-16(20)23-17)22-14(12)10-13(11)18/h2-3,11-14,18H,4-10H2,1H3/b3-2-/t11-,12-,13+,14+,17-/m1/s1 |
| InChIKey | UIMZBTGXAKGHRO-DGMLSPTASA-N |
| XLogP | 1.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|