C18H26O6 — CID 164674676
methyl (2E,5Z)-3-[(4R)-2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl]-6-methyl-8-oxoocta-2,5-dienoate (PubChem CID 164674676) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl (2E,5Z)-3-[(4R)-2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl]-6-methyl-8-oxoocta-2,5-dienoate.
| Compound Name | methyl (2E,5Z)-3-[(4R)-2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl]-6-methyl-8-oxoocta-2,5-dienoate |
|---|---|
| PubChem CID | 164674676 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl (2E,5Z)-3-[(4R)-2-tert-butyl-4-methyl-5-oxo-1,3-dioxolan-4-yl]-6-methyl-8-oxoocta-2,5-dienoate |
| SMILES | COC(=O)/C=C(\C/C=C(/C)CC=O)[C@@]1(C)OC(C(C)(C)C)OC1=O |
| InChI | InChI=1S/C18H26O6/c1-12(9-10-19)7-8-13(11-14(20)22-6)18(5)15(21)23-16(24-18)17(2,3)4/h7,10-11,16H,8-9H2,1-6H3/b12-7-,13-11+/t16?,18-/m1/s1 |
| InChIKey | OFOORIUZKKSCJH-NEUGCNLWSA-N |
| XLogP | 2.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|