C12H14O4 — CID 164674822
(1R,3R,6S,9S,10S,11S,13R)-13-methoxy-2,7-dioxatetracyclo[7.3.1.03,11.06,10]tridec-4-en-8-one (PubChem CID 164674822) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1R,3R,6S,9S,10S,11S,13R)-13-methoxy-2,7-dioxatetracyclo[7.3.1.03,11.06,10]tridec-4-en-8-one.
| Compound Name | (1R,3R,6S,9S,10S,11S,13R)-13-methoxy-2,7-dioxatetracyclo[7.3.1.03,11.06,10]tridec-4-en-8-one |
|---|---|
| PubChem CID | 164674822 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1R,3R,6S,9S,10S,11S,13R)-13-methoxy-2,7-dioxatetracyclo[7.3.1.03,11.06,10]tridec-4-en-8-one |
| SMILES | CO[C@@H]1[C@H]2C(=O)O[C@H]3C=C[C@H]4O[C@@H]1C[C@H]4[C@@H]23 |
| InChI | InChI=1S/C12H14O4/c1-14-11-8-4-5-6(15-8)2-3-7-9(5)10(11)12(13)16-7/h2-3,5-11H,4H2,1H3/t5-,6-,7+,8-,9-,10+,11+/m1/s1 |
| InChIKey | SBRSHIXZWMPIBU-VCUYNBBDSA-N |
| XLogP | 0.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|