C21H16F3NO3 — CID 164674869
[(E)-3-[4-(2-phenylethynyl)phenyl]prop-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 164674869) has the molecular formula C21H16F3NO3 and a molecular weight of 387.36 g/mol. Its IUPAC name is [(E)-3-[4-(2-phenylethynyl)phenyl]prop-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | [(E)-3-[4-(2-phenylethynyl)phenyl]prop-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 164674869 |
| Molecular Formula | C21H16F3NO3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(E)-3-[4-(2-phenylethynyl)phenyl]prop-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | O=C(CNC(=O)C(F)(F)F)OC/C=C/c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H16F3NO3/c22-21(23,24)20(27)25-15-19(26)28-14-4-7-17-9-12-18(13-10-17)11-8-16-5-2-1-3-6-16/h1-7,9-10,12-13H,14-15H2,(H,25,27)/b7-4+ |
| InChIKey | BQFIYZOYQKQOBD-QPJJXVBHSA-N |
| XLogP | 3.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|