C24H47IO4Si — CID 164674878
(E,4S,5R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-iodo-9-[(2S,4R,6S)-4-methoxy-6-methyloxan-2-yl]-5,7-dimethylnon-1-en-4-ol (PubChem CID 164674878) has the molecular formula C24H47IO4Si and a molecular weight of 554.63 g/mol. Its IUPAC name is (E,4S,5R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-iodo-9-[(2S,4R,6S)-4-methoxy-6-methyloxan-2-yl]-5,7-dimethylnon-1-en-4-ol.
| Compound Name | (E,4S,5R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-iodo-9-[(2S,4R,6S)-4-methoxy-6-methyloxan-2-yl]-5,7-dimethylnon-1-en-4-ol |
|---|---|
| PubChem CID | 164674878 |
| Molecular Formula | C24H47IO4Si |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | (E,4S,5R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-iodo-9-[(2S,4R,6S)-4-methoxy-6-methyloxan-2-yl]-5,7-dimethylnon-1-en-4-ol |
| SMILES | CO[C@H]1C[C@H](CC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)C/C=C/I)O[C@@H](C)C1 |
| InChI | InChI=1S/C24H47IO4Si/c1-17(12-13-20-16-21(27-7)15-18(2)28-20)23(19(3)22(26)11-10-14-25)29-30(8,9)24(4,5)6/h10,14,17-23,26H,11-13,15-16H2,1-9H3/b14-10+/t17-,18-,19+,20-,21+,22-,23-/m0/s1 |
| InChIKey | BSOLSBNYCNGOES-HWYYBPEISA-N |
| XLogP | 6.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|