About 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine
2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine (PubChem CID 164674941) has the molecular formula C8H6Cl3F2NO
and a molecular weight of 276.50 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine.
Molecular Properties
| Compound Name | 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine |
| PubChem CID | 164674941 |
| Molecular Formula | C8H6Cl3F2NO |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine |
| SMILES | FC(F)CCOc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl3F2NO/c9-4-3-5(10)8(14-7(4)11)15-2-1-6(12)13/h3,6H,1-2H2 |
| InChIKey | MXPWWKNISZKEBD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine?
The IUPAC name of 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine (CID 164674941) is 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine.
What is the SMILES notation for 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine?
The canonical SMILES for 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine is FC(F)CCOc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine?
The InChIKey is MXPWWKNISZKEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl3F2NO/c9-4-3-5(10)8(14-7(4)11)15-2-1-6(12)13/h3,6H,1-2H2.
What are the key properties of 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine?
2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine has a molecular weight of 276.50 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trichloro-6-(3,3-difluoropropoxy)pyridine is sourced from PubChem (CID 164674941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).