C24H36O8 — CID 164674991
ethyl (E)-3-[(2R,3S)-3-[(2S,3R)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate (PubChem CID 164674991) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3S)-3-[(2S,3R)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3S)-3-[(2S,3R)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 164674991 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | ethyl (E)-3-[(2R,3S)-3-[(2S,3R)-3-[(S)-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethyl]-1,4-dioxaspiro[4.5]decan-2-yl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@@H]1[C@@H]1OC2(CCCCC2)O[C@@H]1[C@@H](O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C24H36O8/c1-2-27-18(25)10-9-16-20(29-16)22-21(31-24(32-22)13-7-4-8-14-24)19(26)17-15-28-23(30-17)11-5-3-6-12-23/h9-10,16-17,19-22,26H,2-8,11-15H2,1H3/b10-9+/t16-,17-,19+,20+,21-,22+/m1/s1 |
| InChIKey | WBXKJHDRONAGHE-VZJUAFGLSA-N |
| XLogP | 2.75 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|