About 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one
6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one (PubChem CID 164675004) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one |
| PubChem CID | 164675004 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one |
| SMILES | C=CC1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C9H12O3/c1-5-7-6(2)8(10)12-9(3,4)11-7/h5H,1H2,2-4H3 |
| InChIKey | IGBYBTOMQVCUIA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one?
The IUPAC name of 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one (CID 164675004) is 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one?
The canonical SMILES for 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one is C=CC1=C(C)C(=O)OC(C)(C)O1.
What is the InChIKey of 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one?
The InChIKey is IGBYBTOMQVCUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-5-7-6(2)8(10)12-9(3,4)11-7/h5H,1H2,2-4H3.
What are the key properties of 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one?
6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one has a molecular weight of 168.19 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 164675004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).