C9H12O3 — CID 164675004
6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one (PubChem CID 164675004) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one.
| Compound Name | 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 164675004 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 6-ethenyl-2,2,5-trimethyl-1,3-dioxin-4-one |
| SMILES | C=CC1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C9H12O3/c1-5-7-6(2)8(10)12-9(3,4)11-7/h5H,1H2,2-4H3 |
| InChIKey | IGBYBTOMQVCUIA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |