C26H38O3 — CID 164675055
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4,4-dimethyl-2-(2-oxoethyl)pentyl]benzoate (PubChem CID 164675055) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4,4-dimethyl-2-(2-oxoethyl)pentyl]benzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4,4-dimethyl-2-(2-oxoethyl)pentyl]benzoate |
|---|---|
| PubChem CID | 164675055 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4,4-dimethyl-2-(2-oxoethyl)pentyl]benzoate |
| SMILES | CC(C)(C)CC(CC=O)Cc1ccc(C(=O)OC2CC3CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C26H38O3/c1-24(2,3)17-19(12-14-27)15-18-7-9-20(10-8-18)23(28)29-22-16-21-11-13-26(22,6)25(21,4)5/h7-10,14,19,21-22H,11-13,15-17H2,1-6H3 |
| InChIKey | MNDIXDILDQUKBC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|