About (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane
(1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane (PubChem CID 164675124) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane.
Analyze (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane?
The IUPAC name of (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane (CID 164675124) is (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane is C[C@H]1[C@H]2C[C@H]2CN1C.
What is the InChIKey of (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane?
The InChIKey is NBVZLQUGXTYKQM-LYFYHCNISA-N. The full InChI is InChI=1S/C7H13N/c1-5-7-3-6(7)4-8(5)2/h5-7H,3-4H2,1-2H3/t5-,6-,7+/m0/s1.
What are the key properties of (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane?
(1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane has a molecular weight of 111.19 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S,5R)-2,3-dimethyl-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 164675124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).