C31H48O4Si — CID 164675510
[(R)-[(1R,3aR,4R,5R,7aR)-1-hydroxy-1,3,3,6-tetramethyl-5-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydro-2H-inden-4-yl]-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl] acetate (PubChem CID 164675510) has the molecular formula C31H48O4Si and a molecular weight of 512.81 g/mol. Its IUPAC name is [(R)-[(1R,3aR,4R,5R,7aR)-1-hydroxy-1,3,3,6-tetramethyl-5-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydro-2H-inden-4-yl]-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl] acetate.
| Compound Name | [(R)-[(1R,3aR,4R,5R,7aR)-1-hydroxy-1,3,3,6-tetramethyl-5-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydro-2H-inden-4-yl]-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl] acetate |
|---|---|
| PubChem CID | 164675510 |
| Molecular Formula | C31H48O4Si |
| Molecular Weight | 512.81 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | [(R)-[(1R,3aR,4R,5R,7aR)-1-hydroxy-1,3,3,6-tetramethyl-5-[(Z)-prop-1-enyl]-3a,4,5,7a-tetrahydro-2H-inden-4-yl]-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl] acetate |
| SMILES | C/C=C\[C@H]1C(C)=C[C@@H]2[C@@H]([C@H]1[C@@H](OC(C)=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1)C(C)(C)C[C@@]2(C)O |
| InChI | InChI=1S/C31H48O4Si/c1-12-13-24-20(2)18-25-27(30(7,8)19-31(25,9)33)26(24)28(34-21(3)32)22-14-16-23(17-15-22)35-36(10,11)29(4,5)6/h12-18,24-28,33H,19H2,1-11H3/b13-12-/t24-,25+,26-,27-,28-,31+/m0/s1 |
| InChIKey | CURGDVIBGQZPOP-PDOAVANOSA-N |
| XLogP | 7.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.81 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|