About benzyl 2-diazo-3,3,3-trifluoropropanoate
benzyl 2-diazo-3,3,3-trifluoropropanoate (PubChem CID 164675538) has the molecular formula C10H7F3N2O2
and a molecular weight of 244.17 g/mol. Its IUPAC name is benzyl 2-diazo-3,3,3-trifluoropropanoate.
Molecular Properties
| Compound Name | benzyl 2-diazo-3,3,3-trifluoropropanoate |
| PubChem CID | 164675538 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | benzyl 2-diazo-3,3,3-trifluoropropanoate |
| SMILES | [N-]=[N+]=C(C(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)8(15-14)9(16)17-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | PRXMLLYQXAWUND-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-diazo-3,3,3-trifluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-diazo-3,3,3-trifluoropropanoate?
The IUPAC name of benzyl 2-diazo-3,3,3-trifluoropropanoate (CID 164675538) is benzyl 2-diazo-3,3,3-trifluoropropanoate.
What is the SMILES notation for benzyl 2-diazo-3,3,3-trifluoropropanoate?
The canonical SMILES for benzyl 2-diazo-3,3,3-trifluoropropanoate is [N-]=[N+]=C(C(=O)OCc1ccccc1)C(F)(F)F.
What is the InChIKey of benzyl 2-diazo-3,3,3-trifluoropropanoate?
The InChIKey is PRXMLLYQXAWUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O2/c11-10(12,13)8(15-14)9(16)17-6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of benzyl 2-diazo-3,3,3-trifluoropropanoate?
benzyl 2-diazo-3,3,3-trifluoropropanoate has a molecular weight of 244.17 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-diazo-3,3,3-trifluoropropanoate is sourced from PubChem (CID 164675538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).