C16H32O2Si2 — CID 164675582
[(4aS,8aS)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane (PubChem CID 164675582) has the molecular formula C16H32O2Si2 and a molecular weight of 312.60 g/mol. Its IUPAC name is [(4aS,8aS)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane.
| Compound Name | [(4aS,8aS)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 164675582 |
| Molecular Formula | C16H32O2Si2 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(4aS,8aS)-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=CC[C@@H]2CCCC[C@]2(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H32O2Si2/c1-19(2,3)17-15-11-10-14-9-7-8-12-16(14,13-15)18-20(4,5)6/h11,14H,7-10,12-13H2,1-6H3/t14-,16-/m0/s1 |
| InChIKey | XGBDDXBRSKWTSF-HOCLYGCPSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|