C26H26F2O5 — CID 164675602
[(3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxo-6-phenylhexyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 164675602) has the molecular formula C26H26F2O5 and a molecular weight of 456.49 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxo-6-phenylhexyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxo-6-phenylhexyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 164675602 |
| Molecular Formula | C26H26F2O5 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxo-6-phenylhexyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1C[C@@H]2[C@@H](CCC(=O)C(F)(F)CCc3ccccc3)[C@H](OC(=O)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C26H26F2O5/c27-26(28,14-13-17-7-3-1-4-8-17)23(29)12-11-19-20-15-24(30)32-22(20)16-21(19)33-25(31)18-9-5-2-6-10-18/h1-10,19-22H,11-16H2/t19-,20-,21-,22+/m1/s1 |
| InChIKey | SVGNZKDLQVKMHT-YSFYHYPLSA-N |
| XLogP | 4.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |