About 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole
2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole (PubChem CID 164675620) has the molecular formula C25H21N3S
and a molecular weight of 395.53 g/mol. Its IUPAC name is 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole |
| PubChem CID | 164675620 |
| Molecular Formula | C25H21N3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole |
| SMILES | c1ccc(C(c2csc(C(c3ccccc3)c3ccc[nH]3)n2)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C25H21N3S/c1-3-9-18(10-4-1)23(20-13-7-15-26-20)22-17-29-25(28-22)24(21-14-8-16-27-21)19-11-5-2-6-12-19/h1-17,23-24,26-27H |
| InChIKey | YHWVNGZEEAJQGX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole?
The IUPAC name of 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole (CID 164675620) is 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole.
What is the SMILES notation for 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole?
The canonical SMILES for 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole is c1ccc(C(c2csc(C(c3ccccc3)c3ccc[nH]3)n2)c2ccc[nH]2)cc1.
What is the InChIKey of 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole?
The InChIKey is YHWVNGZEEAJQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3S/c1-3-9-18(10-4-1)23(20-13-7-15-26-20)22-17-29-25(28-22)24(21-14-8-16-27-21)19-11-5-2-6-12-19/h1-17,23-24,26-27H.
What are the key properties of 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole?
2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole has a molecular weight of 395.53 g/mol, XLogP of 6.16, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis[phenyl(1H-pyrrol-2-yl)methyl]-1,3-thiazole is sourced from PubChem (CID 164675620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).