C20H28O2 — CID 164675721
(1S,5S,9R,11R,14R)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-3-en-13-one (PubChem CID 164675721) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1S,5S,9R,11R,14R)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-3-en-13-one.
| Compound Name | (1S,5S,9R,11R,14R)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-3-en-13-one |
|---|---|
| PubChem CID | 164675721 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1S,5S,9R,11R,14R)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-3-en-13-one |
| SMILES | C=C1CC[C@H]2C(C)=CC[C@@]34O[C@@]12C[C@]3(C)CC(=O)[C@@H]4C(C)C |
| InChI | InChI=1S/C20H28O2/c1-12(2)17-16(21)10-18(5)11-19-14(4)6-7-15(19)13(3)8-9-20(17,18)22-19/h8,12,15,17H,4,6-7,9-11H2,1-3,5H3/t15-,17-,18-,19-,20-/m0/s1 |
| InChIKey | HKLBRFRCMIQEEM-JBDAPHQKSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|