C20H26O3 — CID 164675722
(1S,5S,9R,11S)-13-hydroxy-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one (PubChem CID 164675722) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1S,5S,9R,11S)-13-hydroxy-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one.
| Compound Name | (1S,5S,9R,11S)-13-hydroxy-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one |
|---|---|
| PubChem CID | 164675722 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1S,5S,9R,11S)-13-hydroxy-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one |
| SMILES | C=C1CC[C@H]2C(C)=CC[C@@]34O[C@@]12C[C@]3(C)C(=O)C(O)=C4C(C)C |
| InChI | InChI=1S/C20H26O3/c1-11(2)15-16(21)17(22)18(5)10-19-13(4)6-7-14(19)12(3)8-9-20(15,18)23-19/h8,11,14,21H,4,6-7,9-10H2,1-3,5H3/t14-,18+,19-,20-/m0/s1 |
| InChIKey | GWSLCBQRIIGREP-WBCYEJBOSA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|