C20H26O2 — CID 164675724
(1S,5S,9R,11S)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one (PubChem CID 164675724) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1S,5S,9R,11S)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one.
| Compound Name | (1S,5S,9R,11S)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one |
|---|---|
| PubChem CID | 164675724 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1S,5S,9R,11S)-4,11-dimethyl-8-methylidene-14-propan-2-yl-15-oxatetracyclo[7.5.1.01,11.05,9]pentadeca-3,13-dien-12-one |
| SMILES | C=C1CC[C@H]2C(C)=CC[C@@]34O[C@@]12C[C@]3(C)C(=O)C=C4C(C)C |
| InChI | InChI=1S/C20H26O2/c1-12(2)16-10-17(21)18(5)11-19-14(4)6-7-15(19)13(3)8-9-20(16,18)22-19/h8,10,12,15H,4,6-7,9,11H2,1-3,5H3/t15-,18+,19-,20-/m0/s1 |
| InChIKey | VVWFPNCCLPXOBE-LDTOTXGLSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|