C13H15F3N2O5 — CID 164675738
diethyl 2-(1H-pyrrol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanedioate (PubChem CID 164675738) has the molecular formula C13H15F3N2O5 and a molecular weight of 336.27 g/mol. Its IUPAC name is diethyl 2-(1H-pyrrol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanedioate.
| Compound Name | diethyl 2-(1H-pyrrol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanedioate |
|---|---|
| PubChem CID | 164675738 |
| Molecular Formula | C13H15F3N2O5 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | diethyl 2-(1H-pyrrol-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)C(F)(F)F)(C(=O)OCC)c1ccc[nH]1 |
| InChI | InChI=1S/C13H15F3N2O5/c1-3-22-10(20)12(11(21)23-4-2,8-6-5-7-17-8)18-9(19)13(14,15)16/h5-7,17H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | VGCJJJRPVQOLPZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|